EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O5 |
| Net Charge | 0 |
| Average Mass | 382.541 |
| Monoisotopic Mass | 382.27192 |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H38O5/c1-4-5-14-22(2,26)15-10-12-18-17(19(23)16-20(18)24)11-8-6-7-9-13-21(25)27-3/h10,12,17-18,20,24,26H,4-9,11,13-16H2,1-3H3/b12-10+/t17-,18-,20-,22+/m1/s1 |
| InChIKey | OJLOPKGSLYJEMD-YCVNZHGXSA-N |
| Roles Classification |
|---|
| Applications: | abortifacient A chemical substance that interrupts pregnancy after implantation. oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11R,16S)-misoprostol (CHEBI:63695) has role abortifacient (CHEBI:50691) |
| (11R,16S)-misoprostol (CHEBI:63695) has role anti-ulcer drug (CHEBI:49201) |
| (11R,16S)-misoprostol (CHEBI:63695) has role oxytocic (CHEBI:36063) |
| (11R,16S)-misoprostol (CHEBI:63695) is a methyl (13E)-11,16-dihydroxy-16-methyl-9-oxoprost-13-en-1-oate (CHEBI:63691) |
| (11R,16S)-misoprostol (CHEBI:63695) is enantiomer of (11S,16R)-misoprostol (CHEBI:63698) |
| Incoming Relation(s) |
| misoprostol (CHEBI:63610) has part (11R,16S)-misoprostol (CHEBI:63695) |
| (11S,16R)-misoprostol (CHEBI:63698) is enantiomer of (11R,16S)-misoprostol (CHEBI:63695) |
| IUPAC Name |
|---|
| methyl (11α,13E,16S)-11,16-dihydroxy-16-methyl-9-oxoprost-13-en-1-oate |
| Synonyms | Source |
|---|---|
| (16S)-15-deoxy--16-hydroxy-16-methyl-PGE1 methyl ester | ChEBI |
| methyl 11R,16S-dihydroxy-16-methyl-9-oxoprost-13E-en-1-oate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6092906 | Reaxys |