EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14NO2 |
| Net Charge | +1 |
| Average Mass | 168.216 |
| Monoisotopic Mass | 168.10191 |
| SMILES | C[NH2+]C[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3/p+1/t9-/m0/s1 |
| InChIKey | YRCWQPVGYLYSOX-VIFPVBQESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-synephrine(1+) (CHEBI:63694) is a ammonium ion derivative (CHEBI:35274) |
| D-synephrine(1+) (CHEBI:63694) is a organic cation (CHEBI:25697) |
| D-synephrine(1+) (CHEBI:63694) is conjugate acid of D-synephrine (CHEBI:119) |
| Incoming Relation(s) |
| D-synephrine (CHEBI:119) is conjugate base of D-synephrine(1+) (CHEBI:63694) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-2-(4-hydroxyphenyl)-N-methylethanaminium |
| Synonyms | Source |
|---|---|
| (R)-synephrine | SUBMITTER |
| (R)-synephrine(1+) | ChEBI |
| D-(−)-synephrine | SUBMITTER |
| D-(−)-synephrine(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| (R)-synephrine | UniProt |
| Citations |
|---|