EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N10O25P6 |
| Net Charge | 0 |
| Average Mass | 996.349 |
| Monoisotopic Mass | 995.98093 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H30N10O25P6/c21-15-9-17(25-3-23-15)29(5-27-9)19-13(33)11(31)7(49-19)1-47-56(35,36)51-58(39,40)53-60(43,44)55-61(45,46)54-59(41,42)52-57(37,38)48-2-8-12(32)14(34)20(50-8)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-34H,1-2H2,(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H2,21,23,25)(H2,22,24,26)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | PZCFFCOJNXGTIM-XPWFQUROSA-N |
| Roles Classification |
|---|
| Application: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| P1,P6-bis(5'-adenosyl)hexaphosphate (CHEBI:63689) has role vasoconstrictor agent (CHEBI:50514) |
| P1,P6-bis(5'-adenosyl)hexaphosphate (CHEBI:63689) is a diadenosyl hexaphosphate (CHEBI:63736) |
| P1,P6-bis(5'-adenosyl)hexaphosphate (CHEBI:63689) is conjugate acid of P1,P6-bis(5'-adenosyl)hexaphosphate(6−) (CHEBI:63740) |
| Incoming Relation(s) |
| P1,P6-bis(5'-adenosyl)hexaphosphate(6−) (CHEBI:63740) is conjugate base of P1,P6-bis(5'-adenosyl)hexaphosphate (CHEBI:63689) |
| IUPAC Name |
|---|
| adenosine(5')hexaphospho(5')adenosine |
| Synonyms | Source |
|---|---|
| Adenosine 5'-hexaphosphate 5'-ester with adenosine | HMDB |
| Adenosine-(5')-hexaphospho-(5')-adenosine | HMDB |
| Ap(6)A | ChemIDplus |
| AP6A | HMDB |
| AppppppA | HMDB |
| Diadenosine 5',5''''-P1,P6-hexaphosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| B6P | PDBeChem |
| HMDB0001282 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5230931 | Reaxys |
| CAS:56983-23-4 | ChemIDplus |
| Citations |
|---|