EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O9 |
| Net Charge | 0 |
| Average Mass | 520.619 |
| Monoisotopic Mass | 520.26723 |
| SMILES | [H][C@]12C[C@]([H])(OC(C)=O)C(C)=C([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]3(C)[C@@H](O)C[C@H](OC(C)=O)C(=C)[C@@]3([H])C1)C2(C)C |
| InChI | InChI=1S/C28H40O9/c1-13-20-10-19-11-21(34-15(3)29)14(2)24(27(19,7)8)25(36-17(5)31)26(37-18(6)32)28(20,9)23(33)12-22(13)35-16(4)30/h19-23,25-26,33H,1,10-12H2,2-9H3/t19-,20-,21+,22+,23+,25-,26+,28+/m1/s1 |
| InChIKey | CNURLWAZNDLNMK-CNZAUHOSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-hydroxytaxusin (CHEBI:63665) has functional parent taxusin (CHEBI:63664) |
| 7β-hydroxytaxusin (CHEBI:63665) has role metabolite (CHEBI:25212) |
| 7β-hydroxytaxusin (CHEBI:63665) is a acetate ester (CHEBI:47622) |
| 7β-hydroxytaxusin (CHEBI:63665) is a carbotricyclic compound (CHEBI:38032) |
| 7β-hydroxytaxusin (CHEBI:63665) is a secondary alcohol (CHEBI:35681) |
| 7β-hydroxytaxusin (CHEBI:63665) is a taxane diterpenoid (CHEBI:50367) |
| IUPAC Name |
|---|
| (5α,7β,9α,10β,13α)-7-hydroxytaxa-4(20),11-diene-5,9,10,13-tetrayl tetraacetate |
| UniProt Name | Source |
|---|---|
| 7β-hydroxytaxusin | UniProt |
| Citations |
|---|