EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O2 |
| Net Charge | -1 |
| Average Mass | 301.450 |
| Monoisotopic Mass | 301.21730 |
| SMILES | [H][C@@]12CC=C3C[C@](C)(C=C)CC[C@@]3([H])[C@@]1(C)CCC[C@]2(C)C(=O)[O-] |
| InChI | InChI=1S/C20H30O2/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(21)22/h5,7,15-16H,1,6,8-13H2,2-4H3,(H,21,22)/p-1/t15-,16-,18-,19-,20+/m1/s1 |
| InChIKey | MXYATHGRPJZBNA-BDUQCRIQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9β-pimara-7,15-dien-19-oate (CHEBI:63659) is a monocarboxylic acid anion (CHEBI:35757) |
| 9β-pimara-7,15-dien-19-oate (CHEBI:63659) is conjugate base of 9β-pimara-7,15-dien-19-oic acid (CHEBI:63731) |
| Incoming Relation(s) |
| 9β-pimara-7,15-dien-19-oic acid (CHEBI:63731) is conjugate acid of 9β-pimara-7,15-dien-19-oate (CHEBI:63659) |
| IUPAC Name |
|---|
| (9β)-pimara-7,15-dien-19-oate |
| Synonym | Source |
|---|---|
| (1S,4aR,4bR,7R,10aR)-7-ethenyl-1,4a,7-trimethyl-1,2,3,4,4a,4b,5,6,7,8,10,10a-dodecahydrophenanthrene-1-carboxylate | IUPAC |
| UniProt Name | Source |
|---|---|
| 9β-pimara-7,15-dien-19-oate | UniProt |
| Citations |
|---|