EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | C=CC(N)CCC(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-2-5(7)3-4-6(8)9/h2,5H,1,3-4,7H2,(H,8,9) |
| InChIKey | PJDFLNIOAUIZSL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.6.1.19 (4-aminobutyrate--2-oxoglutarate transaminase) inhibitor An EC 2.6.1.* (transaminase) inhibitor that interferes with the action of 4-aminobutyrate—2-oxoglutarate transaminase (EC 2.6.1.19). |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vigabatrin (CHEBI:63638) has role anticonvulsant (CHEBI:35623) |
| vigabatrin (CHEBI:63638) has role EC 2.6.1.19 (4-aminobutyrate—2-oxoglutarate transaminase) inhibitor (CHEBI:63674) |
| vigabatrin (CHEBI:63638) is a γ-amino acid (CHEBI:33707) |
| IUPAC Name |
|---|
| 4-aminohex-5-enoic acid |
| INNs | Source |
|---|---|
| vigabatrin | ChemIDplus |
| vigabatrina | ChemIDplus |
| vigabatrine | ChemIDplus |
| vigabatrinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Amino-5-hexenoic acid | ChemIDplus |
| gamma-vinyl GABA | ChEBI |
| gamma-Vinyl GABA | ChemIDplus |
| GVG | ChemIDplus |
| γ-vinyl GABA | ChEBI |
| γ-vinyl-γ-aminobutyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:60643-86-9 | KEGG COMPOUND |
| CAS:60643-86-9 | ChemIDplus |
| Citations |
|---|