EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C64H82N18O13 |
| Net Charge | 0 |
| Average Mass | 1311.473 |
| Monoisotopic Mass | 1310.63087 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O |
| InChI | InChI=1S/C64H82N18O13/c1-34(2)23-46(56(88)75-45(13-7-21-69-64(66)67)63(95)82-22-8-14-52(82)62(94)72-31-53(65)85)76-58(90)48(25-36-28-70-42-11-5-3-9-40(36)42)78-57(89)47(24-35-15-17-39(84)18-16-35)77-61(93)51(32-83)81-59(91)49(26-37-29-71-43-12-6-4-10-41(37)43)79-60(92)50(27-38-30-68-33-73-38)80-55(87)44-19-20-54(86)74-44/h3-6,9-12,15-18,28-30,33-34,44-52,70-71,83-84H,7-8,13-14,19-27,31-32H2,1-2H3,(H2,65,85)(H,68,73)(H,72,94)(H,74,86)(H,75,88)(H,76,90)(H,77,93)(H,78,89)(H,79,92)(H,80,87)(H,81,91)(H4,66,67,69)/t44-,45-,46-,47-,48+,49-,50-,51-,52-/m0/s1 |
| InChIKey | VXKHXGOKWPXYNA-PGBVPBMZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. contraceptive drug A chemical substance that prevents or reduces the probability of conception. gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triptorelin (CHEBI:63633) has role antineoplastic agent (CHEBI:35610) |
| triptorelin (CHEBI:63633) has role contraceptive drug (CHEBI:49323) |
| triptorelin (CHEBI:63633) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| triptorelin (CHEBI:63633) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-tryptophyl-L-leucyl-L-arginyl-L-prolylglycinamide |
| INNs | Source |
|---|---|
| triptorelin | ChemIDplus |
| triptorelina | ChemIDplus |
| triptoreline | ChemIDplus |
| triptorelinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6-D-Tryptophan)luteinizing hormone-releasing hormone | ChemIDplus |
| (D-Trp6)-GnRH | ChemIDplus |
| Luteinizing hormone-releasing factor (pig), 6-D-tryptophan | ChemIDplus |
| pGlu-His-Trp-Ser-Tyr-D-Trp-Leu-Arg-Pro-Gly-NH2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2968 | DrugCentral |
| D06247 | KEGG DRUG |
| EP1354952 | Patent |
| Triptorelin | Wikipedia |
| US2002111603 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9317315 | Reaxys |
| CAS:57773-63-4 | ChemIDplus |
| Citations |
|---|