EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21NO8S |
| Net Charge | 0 |
| Average Mass | 339.366 |
| Monoisotopic Mass | 339.09879 |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7-,8-,9+,12+/m1/s1 |
| InChIKey | KJADKKWYZYXHBB-XBWDGYHZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| topiramate (CHEBI:63631) has role anticonvulsant (CHEBI:35623) |
| topiramate (CHEBI:63631) has role sodium channel blocker (CHEBI:38633) |
| topiramate (CHEBI:63631) is a cyclic ketal (CHEBI:59779) |
| topiramate (CHEBI:63631) is a ketohexose derivative (CHEBI:63391) |
| topiramate (CHEBI:63631) is a sulfamate ester (CHEBI:48199) |
| INNs | Source |
|---|---|
| topiramate | ChemIDplus |
| topiramato | ChemIDplus |
| topiramatum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Topiramate | KEGG COMPOUND |
| 2,3:4,5-di-O-isopropylidene-β-D-fructopyranose sulfamate | ChemIDplus |
| 2,3:4,5-bis-O-(1-methylethylidene)-β-D-fructopyranose sulfamate | ChemIDplus |
| RWJ-17021 | ChemIDplus |
| TPM | ChEBI |
| tipiramato | DrugBank |
| Brand Name | Source |
|---|---|
| Topamax | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5988957 | Reaxys |
| CAS:97240-79-4 | KEGG COMPOUND |
| CAS:97240-79-4 | ChemIDplus |
| Citations |
|---|