EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11NO5 |
| Net Charge | 0 |
| Average Mass | 273.244 |
| Monoisotopic Mass | 273.06372 |
| SMILES | Cc1ccc(C(=O)c2cc(O)c(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C14H11NO5/c1-8-2-4-9(5-3-8)13(17)10-6-11(15(19)20)14(18)12(16)7-10/h2-7,16,18H,1H3 |
| InChIKey | MIQPIUSUKVNLNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.1.1.6 (catechol O-methyltransferase) inhibitor An EC 2.1.1.* (methyltransferase) inhibitor that interferes with the action of catechol O-methyltransferase (EC 2.1.1.6). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolcapone (CHEBI:63630) has role antineoplastic agent (CHEBI:35610) |
| tolcapone (CHEBI:63630) has role antiparkinson drug (CHEBI:48407) |
| tolcapone (CHEBI:63630) has role antipsychotic agent (CHEBI:35476) |
| tolcapone (CHEBI:63630) has role EC 2.1.1.6 (catechol O-methyltransferase) inhibitor (CHEBI:48406) |
| tolcapone (CHEBI:63630) has role neuroprotective agent (CHEBI:63726) |
| tolcapone (CHEBI:63630) is a 2-nitrophenols (CHEBI:86421) |
| tolcapone (CHEBI:63630) is a benzophenones (CHEBI:22726) |
| tolcapone (CHEBI:63630) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| (3,4-dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone |
| INNs | Source |
|---|---|
| tolcapona | WHO MedNet |
| tolcapone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxy-4'-methyl-5-nitrobenzophenone | ChEBI |
| 3,4-Dihydroxy-4'-methyl-5-nitrobenzophenone | ChemIDplus |
| 3,4-dihydroxy-5-nitro-4'-methylbenzophenone | ChEBI |
| 4'-methyl-3,4-dihydroxy-5-nitrobenzophenone | ChEBI |
| RO-40-7592 | ChEMBL |
| RO-407592 | ChEMBL |
| Citations |
|---|