EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11NO5 |
| Net Charge | 0 |
| Average Mass | 273.244 |
| Monoisotopic Mass | 273.06372 |
| SMILES | Cc1ccc(C(=O)c2cc(O)c(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C14H11NO5/c1-8-2-4-9(5-3-8)13(17)10-6-11(15(19)20)14(18)12(16)7-10/h2-7,16,18H,1H3 |
| InChIKey | MIQPIUSUKVNLNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.1.1.6 (catechol O-methyltransferase) inhibitor An EC 2.1.1.* (methyltransferase) inhibitor that interferes with the action of catechol O-methyltransferase (EC 2.1.1.6). |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolcapone (CHEBI:63630) has role antineoplastic agent (CHEBI:35610) |
| tolcapone (CHEBI:63630) has role antiparkinson drug (CHEBI:48407) |
| tolcapone (CHEBI:63630) has role antipsychotic agent (CHEBI:35476) |
| tolcapone (CHEBI:63630) has role EC 2.1.1.6 (catechol O-methyltransferase) inhibitor (CHEBI:48406) |
| tolcapone (CHEBI:63630) has role neuroprotective agent (CHEBI:63726) |
| tolcapone (CHEBI:63630) is a 2-nitrophenols (CHEBI:86421) |
| tolcapone (CHEBI:63630) is a benzophenones (CHEBI:22726) |
| tolcapone (CHEBI:63630) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| (3,4-dihydroxy-5-nitrophenyl)(4-methylphenyl)methanone |
| INNs | Source |
|---|---|
| tolcapona | WHO MedNet |
| tolcapone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,4-dihydroxy-4'-methyl-5-nitrobenzophenone | ChEBI |
| 3,4-Dihydroxy-4'-methyl-5-nitrobenzophenone | ChemIDplus |
| 3,4-dihydroxy-5-nitro-4'-methylbenzophenone | ChEBI |
| 4'-methyl-3,4-dihydroxy-5-nitrobenzophenone | ChEBI |
| RO-40-7592 | ChEMBL |
| RO-407592 | ChEMBL |
| Citations |
|---|