EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H33F3N2O5S |
| Net Charge | 0 |
| Average Mass | 602.675 |
| Monoisotopic Mass | 602.20623 |
| SMILES | CCC[C@@]1(CCc2ccccc2)CC(O)=C([C@H](CC)c2cccc(NS(=O)(=O)c3ccc(C(F)(F)F)cn3)c2)C(=O)O1 |
| InChI | InChI=1S/C31H33F3N2O5S/c1-3-16-30(17-15-21-9-6-5-7-10-21)19-26(37)28(29(38)41-30)25(4-2)22-11-8-12-24(18-22)36-42(39,40)27-14-13-23(20-35-27)31(32,33)34/h5-14,18,20,25,36-37H,3-4,15-17,19H2,1-2H3/t25-,30-/m1/s1 |
| InChIKey | SUJUHGSWHZTSEU-FYBSXPHGSA-N |
| Roles Classification |
|---|
| Biological Roles: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tipranavir (CHEBI:63628) has role antiviral drug (CHEBI:36044) |
| tipranavir (CHEBI:63628) has role HIV protease inhibitor (CHEBI:35660) |
| tipranavir (CHEBI:63628) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-(3-{(1R)-1-[(6R)-4-hydroxy-2-oxo-6-(2-phenylethyl)-6-propyl-5,6-dihydro-2H-pyran-3-yl]propyl}phenyl)-5-(trifluoromethyl)pyridine-2-sulfonamide |
| INN | Source |
|---|---|
| tipranavir | ChemIDplus |
| Synonym | Source |
|---|---|
| 3'-((1R)-1-((6R)-5,6-Dihydro-4-hydroxy-2-oxo-6-phenethyl-6-propyl-2H-pyran-3-yl)propyl)-5-(trifluoromethyl)-2-pyridinesulfonanilide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7698323 | Reaxys |
| CAS:174484-41-4 | ChemIDplus |
| Citations |
|---|