EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63627 - tinidazole
| Formula | C8H13N3O4S |
| Net Charge | 0 |
| Average Mass | 247.276 |
| Monoisotopic Mass | 247.06268 |
| SMILES | CCS(=O)(=O)CCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C8H13N3O4S/c1-3-16(14,15)5-4-10-7(2)9-6-8(10)11(12)13/h6H,3-5H2,1-2H3 |
| InChIKey | HJLSLZFTEKNLFI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antibacterial drug A drug used to treat or prevent bacterial infections. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinidazole (CHEBI:63627) has role antiamoebic agent (CHEBI:171664) |
| tinidazole (CHEBI:63627) has role antibacterial agent (CHEBI:33282) |
| tinidazole (CHEBI:63627) has role antibacterial drug (CHEBI:36047) |
| tinidazole (CHEBI:63627) has role antifungal drug (CHEBI:86327) |
| tinidazole (CHEBI:63627) has role antimalarial (CHEBI:38068) |
| tinidazole (CHEBI:63627) has role antineoplastic agent (CHEBI:35610) |
| tinidazole (CHEBI:63627) has role antiparasitic agent (CHEBI:35442) |
| tinidazole (CHEBI:63627) has role antiprotozoal drug (CHEBI:35820) |
| tinidazole (CHEBI:63627) is a C-nitro compound (CHEBI:35716) |
| tinidazole (CHEBI:63627) is a imidazoles (CHEBI:24780) |
| tinidazole (CHEBI:63627) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-[2-(ethylsulfonyl)ethyl]-2-methyl-5-nitro-1H-imidazole |
| Synonyms | Source |
|---|---|
| CP-12,574 | ChEMBL |
| CP-12574 | ChEMBL |
| Fasigin | ChEMBL |
| Haisigyn | ChEMBL |
| NSC-758189 | ChEMBL |
| timidazole | ChEBI |
| Brand Names | Source |
|---|---|
| Fasigyn | ChEMBL |
| Simplotan | ChEMBL |
| Symplotan | ChEMBL |
| Citations |
|---|