EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13N3O4S |
| Net Charge | 0 |
| Average Mass | 247.276 |
| Monoisotopic Mass | 247.06268 |
| SMILES | CCS(=O)(=O)CCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C8H13N3O4S/c1-3-16(14,15)5-4-10-7(2)9-6-8(10)11(12)13/h6H,3-5H2,1-2H3 |
| InChIKey | HJLSLZFTEKNLFI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antibacterial drug A drug used to treat or prevent bacterial infections. antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinidazole (CHEBI:63627) has role antiamoebic agent (CHEBI:171664) |
| tinidazole (CHEBI:63627) has role antibacterial drug (CHEBI:36047) |
| tinidazole (CHEBI:63627) has role antiparasitic agent (CHEBI:35442) |
| tinidazole (CHEBI:63627) has role antiprotozoal drug (CHEBI:35820) |
| tinidazole (CHEBI:63627) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 1-[2-(ethylsulfonyl)ethyl]-2-methyl-5-nitro-1H-imidazole |
| Synonym | Source |
|---|---|
| timidazole | ChEBI |
| Citations |
|---|