EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63627 - tinidazole
| Formula | C8H13N3O4S |
| Net Charge | 0 |
| Average Mass | 247.276 |
| Monoisotopic Mass | 247.06268 |
| SMILES | CCS(=O)(=O)CCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C8H13N3O4S/c1-3-16(14,15)5-4-10-7(2)9-6-8(10)11(12)13/h6H,3-5H2,1-2H3 |
| InChIKey | HJLSLZFTEKNLFI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinidazole (CHEBI:63627) has role antiamoebic agent (CHEBI:171664) |
| tinidazole (CHEBI:63627) has role antibacterial drug (CHEBI:36047) |
| tinidazole (CHEBI:63627) has role antiparasitic agent (CHEBI:35442) |
| tinidazole (CHEBI:63627) has role antiprotozoal drug (CHEBI:35820) |
| tinidazole (CHEBI:63627) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 1-[2-(ethylsulfonyl)ethyl]-2-methyl-5-nitro-1H-imidazole |
| Synonym | Source |
|---|---|
| timidazole | ChEBI |
| Citations |
|---|