EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O5 |
| Net Charge | 0 |
| Average Mass | 242.231 |
| Monoisotopic Mass | 242.09027 |
| SMILES | Cc1cn([C@@H]2C[C@@H](O)[C@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m1/s1 |
| InChIKey | IQFYYKKMVGJFEH-CSMHCCOUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| telbivudine (CHEBI:63624) has functional parent thymine (CHEBI:17821) |
| telbivudine (CHEBI:63624) has role antiviral drug (CHEBI:36044) |
| telbivudine (CHEBI:63624) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| telbivudine (CHEBI:63624) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| telbivudine (CHEBI:63624) is enantiomer of thymidine (CHEBI:17748) |
| Incoming Relation(s) |
| thymidine (CHEBI:17748) is enantiomer of telbivudine (CHEBI:63624) |
| IUPAC Name |
|---|
| 1-(2-deoxy-β-L-erythro-pentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione |
| INN | Source |
|---|---|
| telbivudine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 1-(2-deoxy-β-L-ribofuranosyl)-5-methyluracil | ChEBI |
| 2'-Deoxy-L-thymidine | DrugBank |
| Beta-l-thymidine | DrugBank |
| Epavudine | DrugBank |
| L-deoxythymidine | DrugBank |
| L-DT | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 4220 | DrugCentral |
| D06675 | KEGG DRUG |
| DB01265 | DrugBank |
| Telbivudine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:754297 | Reaxys |
| CAS:3424-98-4 | ChemIDplus |
| Citations |
|---|