EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4S2 |
| Net Charge | 0 |
| Average Mass | 182.222 |
| Monoisotopic Mass | 181.97075 |
| SMILES | O=C(O)[C@@H](S)[C@@H](S)C(=O)O |
| InChI | InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/t1-,2+ |
| InChIKey | ACTRVOBWPAIOHC-XIXRPRMCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succimer (CHEBI:63623) has role chelator (CHEBI:38161) |
| succimer (CHEBI:63623) is a dicarboxylic acid (CHEBI:35692) |
| succimer (CHEBI:63623) is a dithiol (CHEBI:23853) |
| succimer (CHEBI:63623) is a sulfur-containing carboxylic acid (CHEBI:33576) |
| IUPAC Name |
|---|
| (2R,3S)-2,3-disulfanylsuccinic acid |
| INNs | Source |
|---|---|
| succimer | KEGG DRUG |
| succimerum | ChemIDplus |
| succimero | ChemIDplus |
| Synonyms | Source |
|---|---|
| meso-2,3-Dimercaptosuccinic acid | KEGG COMPOUND |
| meso-Dimercaptosuccinic acid | KEGG DRUG |
| DMSA | DrugBank |
| Dimercaptosuccinic acid | DrugBank |
| (R*,S*)-2,3-Dimercaptobutanedioic acid | ChemIDplus |
| meso-2,3-Dimercaptobernsteinsäure | ChEBI |
| Citations |
|---|