EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50N6O5 |
| Net Charge | 0 |
| Average Mass | 670.855 |
| Monoisotopic Mass | 670.38427 |
| SMILES | [H][C@@]12CCCC[C@]1([H])CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)c1ccc3ccccc3n1)[C@H](C(=O)NC(C)(C)C)C2 |
| InChI | InChI=1S/C38H50N6O5/c1-38(2,3)43-37(49)32-20-26-14-7-8-15-27(26)22-44(32)23-33(45)30(19-24-11-5-4-6-12-24)41-36(48)31(21-34(39)46)42-35(47)29-18-17-25-13-9-10-16-28(25)40-29/h4-6,9-13,16-18,26-27,30-33,45H,7-8,14-15,19-23H2,1-3H3,(H2,39,46)(H,41,48)(H,42,47)(H,43,49)/t26-,27+,30-,31-,32-,33+/m0/s1 |
| InChIKey | QWAXKHKRTORLEM-UGJKXSETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral agent A substance that destroys or inhibits replication of viruses. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saquinavir (CHEBI:63621) has role anti-HIV agent (CHEBI:64946) |
| saquinavir (CHEBI:63621) has role antihypertensive agent (CHEBI:35674) |
| saquinavir (CHEBI:63621) has role antiviral agent (CHEBI:22587) |
| saquinavir (CHEBI:63621) has role antiviral drug (CHEBI:36044) |
| saquinavir (CHEBI:63621) has role HIV protease inhibitor (CHEBI:35660) |
| saquinavir (CHEBI:63621) is a L-asparagine derivative (CHEBI:52987) |
| saquinavir (CHEBI:63621) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| N1-{(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)octahydroisoquinolin-2(1H)-yl]-3-hydroxy-1-phenylbutan-2-yl}-N2-(quinolin-2-ylcarbonyl)-L-aspartamide |
| INN | Source |
|---|---|
| saquinavir | KEGG DRUG |
| Synonyms | Source |
|---|---|
| RO 31-8959/000 | ChEMBL |
| RO-31-8959/000 | ChEMBL |
| Saquinavirum | ChEMBL |
| SCH-52852 | ChEMBL |
| Brand Name | Source |
|---|---|
| Fortovase | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5469491 | Reaxys |
| CAS:127779-20-8 | KEGG DRUG |
| CAS:127779-20-8 | ChemIDplus |
| Citations |
|---|