EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50N6O5 |
| Net Charge | 0 |
| Average Mass | 670.855 |
| Monoisotopic Mass | 670.38427 |
| SMILES | [H][C@@]12CCCC[C@]1([H])CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)c1ccc3ccccc3n1)[C@H](C(=O)NC(C)(C)C)C2 |
| InChI | InChI=1S/C38H50N6O5/c1-38(2,3)43-37(49)32-20-26-14-7-8-15-27(26)22-44(32)23-33(45)30(19-24-11-5-4-6-12-24)41-36(48)31(21-34(39)46)42-35(47)29-18-17-25-13-9-10-16-28(25)40-29/h4-6,9-13,16-18,26-27,30-33,45H,7-8,14-15,19-23H2,1-3H3,(H2,39,46)(H,41,48)(H,42,47)(H,43,49)/t26-,27+,30-,31-,32-,33+/m0/s1 |
| InChIKey | QWAXKHKRTORLEM-UGJKXSETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saquinavir (CHEBI:63621) has role antiviral drug (CHEBI:36044) |
| saquinavir (CHEBI:63621) has role HIV protease inhibitor (CHEBI:35660) |
| saquinavir (CHEBI:63621) is a L-asparagine derivative (CHEBI:52987) |
| saquinavir (CHEBI:63621) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| N1-{(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)octahydroisoquinolin-2(1H)-yl]-3-hydroxy-1-phenylbutan-2-yl}-N2-(quinolin-2-ylcarbonyl)-L-aspartamide |
| INN | Source |
|---|---|
| saquinavir | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Fortovase | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5469491 | Reaxys |
| CAS:127779-20-8 | ChemIDplus |
| CAS:127779-20-8 | KEGG DRUG |
| Citations |
|---|