EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N |
| Net Charge | 0 |
| Average Mass | 171.243 |
| Monoisotopic Mass | 171.10480 |
| SMILES | C#CCN[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H13N/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12/h1,3-6,12-13H,7-9H2/t12-/m1/s1 |
| InChIKey | RUOKEQAAGRXIBM-GFCCVEGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rasagiline (CHEBI:63620) has role antiparkinson drug (CHEBI:48407) |
| rasagiline (CHEBI:63620) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| rasagiline (CHEBI:63620) has role neuroprotective agent (CHEBI:63726) |
| rasagiline (CHEBI:63620) is a indanes (CHEBI:46940) |
| rasagiline (CHEBI:63620) is a secondary amine (CHEBI:32863) |
| rasagiline (CHEBI:63620) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| (1R)-N-(prop-2-yn-1-yl)indan-1-amine |
| INNs | Source |
|---|---|
| rasagilina | WHO MedNet |
| rasagiline | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (1R)-N-propargylindan-1-amine | ChEBI |
| AGN-1135 | ChEMBL |
| (R)-indan-1-yl-prop-2-ynyl-amine | ChEBI |
| NSC-759639 | ChEMBL |
| RAS | DrugBank |
| (R)-N-2-Propynyl-1-indanamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08469 | KEGG DRUG |
| DB01367 | DrugBank |
| Rasagiline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9194207 | Reaxys |
| CAS:136236-51-6 | KEGG DRUG |
| CAS:136236-51-6 | ChemIDplus |
| Citations |
|---|