EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO3 |
| Net Charge | 0 |
| Average Mass | 341.451 |
| Monoisotopic Mass | 341.19909 |
| SMILES | CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C21H27NO3/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17/h3-11,18,22-23H,2,12-16H2,1H3 |
| InChIKey | JWHAUXFOSRPERK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propafenone (CHEBI:63619) has role anti-arrhythmia drug (CHEBI:38070) |
| propafenone (CHEBI:63619) is a aromatic ketone (CHEBI:76224) |
| propafenone (CHEBI:63619) is a secondary alcohol (CHEBI:35681) |
| propafenone (CHEBI:63619) is a secondary amino compound (CHEBI:50995) |
| propafenone (CHEBI:63619) is conjugate base of propafenone(1+) (CHEBI:63650) |
| Incoming Relation(s) |
| propafenone(1+) (CHEBI:63650) is conjugate acid of propafenone (CHEBI:63619) |
| IUPAC Name |
|---|
| 1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one |
| INNs | Source |
|---|---|
| propafenona | ChemIDplus |
| propafenone | ChemIDplus |
| propafenonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-(2-hydroxy-3-(propylamino)propoxy)phenyl)-3-phenyl-1-propanone | ChemIDplus |
| 2-(2'-hydroxy-3'-propylaminopropoxy)-ω-phenylpropiophenone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2175182 | Reaxys |
| CAS:54063-53-5 | KEGG COMPOUND |
| CAS:54063-53-5 | ChemIDplus |
| Citations |
|---|