EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2S |
| Net Charge | 0 |
| Average Mass | 314.498 |
| Monoisotopic Mass | 314.18167 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](CSC)CN2CCC |
| InChI | InChI=1S/C19H26N2S/c1-3-7-21-11-13(12-22-2)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3/t13-,16-,18-/m1/s1 |
| InChIKey | YEHCICAEULNIGD-MZMPZRCHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine agonist A drug that binds to and activates dopamine receptors. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. dopamine agonist A drug that binds to and activates dopamine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pergolide (CHEBI:63617) has role antiparkinson drug (CHEBI:48407) |
| pergolide (CHEBI:63617) has role dopamine agonist (CHEBI:51065) |
| pergolide (CHEBI:63617) is a diamine (CHEBI:23666) |
| pergolide (CHEBI:63617) is a methyl sulfide (CHEBI:86315) |
| pergolide (CHEBI:63617) is a organic heterotetracyclic compound (CHEBI:38163) |
| pergolide (CHEBI:63617) is conjugate base of pergolide(1+) (CHEBI:63706) |
| Incoming Relation(s) |
| pergolide(1+) (CHEBI:63706) is conjugate acid of pergolide (CHEBI:63617) |
| IUPAC Name |
|---|
| (8β)-8-[(methylsulfanyl)methyl]-6-propylergoline |
| INNs | Source |
|---|---|
| pergolida | ChemIDplus |
| pergolide | ChemIDplus |
| pergolidum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5091461 | Reaxys |
| CAS:66104-22-1 | KEGG COMPOUND |
| CAS:66104-22-1 | ChemIDplus |
| Citations |
|---|