EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14N4O |
| Net Charge | 0 |
| Average Mass | 266.304 |
| Monoisotopic Mass | 266.11676 |
| SMILES | Cc1ccnc2c1NC(=O)c1cccnc1N2C1CC1 |
| InChI | InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20) |
| InChIKey | NQDJXKOVJZTUJA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nevirapine (CHEBI:63613) has role antiviral drug (CHEBI:36044) |
| nevirapine (CHEBI:63613) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| nevirapine (CHEBI:63613) is a cyclopropanes (CHEBI:51454) |
| nevirapine (CHEBI:63613) is a dipyridodiazepine (CHEBI:63667) |
| Incoming Relation(s) |
| 12-hydroxynevirapine (CHEBI:145206) has functional parent nevirapine (CHEBI:63613) |
| IUPAC Name |
|---|
| 11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one |
| INN | Source |
|---|---|
| nevirapine | ChemIDplus |
| Synonyms | Source |
|---|---|
| 11-cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one | ChemIDplus |
| NEV | DrugBank |
| Nevirapine | KEGG COMPOUND |
| NVP | DrugBank |
| Brand Name | Source |
|---|---|
| Viramune | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4757598 | Reaxys |
| CAS:129618-40-2 | ChemIDplus |
| CAS:129618-40-2 | KEGG COMPOUND |
| Citations |
|---|