EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H41F2N5O |
| Net Charge | 0 |
| Average Mass | 513.677 |
| Monoisotopic Mass | 513.32792 |
| SMILES | Cc1nnc(C(C)C)n1[C@@H]1C[C@H]2CC[C@@H](C1)N2CC[C@H](NC(=O)C1CCC(F)(F)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H41F2N5O/c1-19(2)27-34-33-20(3)36(27)25-17-23-9-10-24(18-25)35(23)16-13-26(21-7-5-4-6-8-21)32-28(37)22-11-14-29(30,31)15-12-22/h4-8,19,22-26H,9-18H2,1-3H3,(H,32,37)/t23-,24+,25-,26-/m0/s1 |
| InChIKey | GSNHKUDZZFZSJB-QYOOZWMWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV fusion inhibitor A drug which interferes with the binding, fusion and entry of an HIV virion to a human cell. By blocking this step in HIV's replication cycle, such agents slow the progression from HIV infection to AIDS. chemokine receptor 5 antagonist An antogonist that blocks chemokine receptor 5 (CCR5). |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV fusion inhibitor A drug which interferes with the binding, fusion and entry of an HIV virion to a human cell. By blocking this step in HIV's replication cycle, such agents slow the progression from HIV infection to AIDS. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maraviroc (CHEBI:63608) has role antiviral drug (CHEBI:36044) |
| maraviroc (CHEBI:63608) has role chemokine receptor 5 antagonist (CHEBI:63673) |
| maraviroc (CHEBI:63608) has role HIV fusion inhibitor (CHEBI:59886) |
| maraviroc (CHEBI:63608) is a azabicycloalkane (CHEBI:38295) |
| maraviroc (CHEBI:63608) is a monocarboxylic acid amide (CHEBI:29347) |
| maraviroc (CHEBI:63608) is a organofluorine compound (CHEBI:37143) |
| maraviroc (CHEBI:63608) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 4,4-difluoro-N-{(1S)-3-[(3-exo)-3-(3-isopropyl-5-methyl-4H-1,2,4-triazol-4-yl)-8-azabicyclo[3.2.1]oct-8-yl]-1-phenylpropyl}cyclohexanecarboxamide |
| INNs | Source |
|---|---|
| maraviroc | KEGG DRUG |
| maraviroc | WHO MedNet |
| maraviroc | WHO MedNet |
| maraviroc | WHO MedNet |
| maravirocum | WHO MedNet |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10131963 | Reaxys |
| CAS:376348-65-1 | ChemIDplus |
| CAS:376348-65-1 | KEGG DRUG |
| Citations |
|---|