EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63607 - linezolid
| Formula | C16H20FN3O4 |
| Net Charge | 0 |
| Average Mass | 337.351 |
| Monoisotopic Mass | 337.14378 |
| SMILES | CC(=O)NC[C@H]1CN(c2ccc(N3CCOCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | TYZROVQLWOKYKF-ZDUSSCGKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linezolid (CHEBI:63607) has role antibacterial drug (CHEBI:36047) |
| linezolid (CHEBI:63607) has role protein synthesis inhibitor (CHEBI:48001) |
| linezolid (CHEBI:63607) is a acetamides (CHEBI:22160) |
| linezolid (CHEBI:63607) is a morpholines (CHEBI:38785) |
| linezolid (CHEBI:63607) is a organofluorine compound (CHEBI:37143) |
| linezolid (CHEBI:63607) is a oxazolidinone (CHEBI:55374) |
| IUPAC Name |
|---|
| N-({(5S)-3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide |
| INN | Source |
|---|---|
| linezolid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Linezolid | KEGG COMPOUND |
| N-(((S)-3-(3-Fluoro-4-morpholinophenyl)-2-oxo-5-oxazolidinyl)methyl)acetamide | ChemIDplus |
| Citations |
|---|