EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42N2O5S |
| Net Charge | 0 |
| Average Mass | 506.709 |
| Monoisotopic Mass | 506.28144 |
| SMILES | [H][C@]12C[C@@H](/C(C)=C/c3csc(C)n3)NC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC[C@@]1(C)O2 |
| InChI | InChI=1S/C27H42N2O5S/c1-15-9-8-10-27(7)22(34-27)12-20(16(2)11-19-14-35-18(4)28-19)29-23(31)13-21(30)26(5,6)25(33)17(3)24(15)32/h11,14-15,17,20-22,24,30,32H,8-10,12-13H2,1-7H3,(H,29,31)/b16-11+/t15-,17+,20-,21-,22-,24-,27+/m0/s1 |
| InChIKey | FABUFPQFXZVHFB-PVYNADRNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | microtubule-destabilising agent Any substance that interacts with tubulin to inhibit polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ixabepilone (CHEBI:63605) has role antineoplastic agent (CHEBI:35610) |
| ixabepilone (CHEBI:63605) has role microtubule-destabilising agent (CHEBI:61951) |
| ixabepilone (CHEBI:63605) is a 1,3-thiazoles (CHEBI:38418) |
| ixabepilone (CHEBI:63605) is a epoxide (CHEBI:32955) |
| ixabepilone (CHEBI:63605) is a lactam (CHEBI:24995) |
| ixabepilone (CHEBI:63605) is a macrocycle (CHEBI:51026) |
| ixabepilone (CHEBI:63605) is a β-hydroxy ketone (CHEBI:55380) |
| INN | Source |
|---|---|
| ixabepilone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| BMS-247550 | DrugBank |
| Azaepothilone B | DrugBank |
| Aza-epothilone B | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D04645 | KEGG DRUG |
| DB04845 | DrugBank |
| Ixabepilone | Wikipedia |
| 1517 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8811748 | Reaxys |
| CAS:219989-84-1 | KEGG DRUG |
| CAS:219989-84-1 | ChemIDplus |
| Citations |
|---|