EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O6 |
| Net Charge | 0 |
| Average Mass | 410.466 |
| Monoisotopic Mass | 410.17294 |
| SMILES | COc1c(O)cc2oc3cc(O)c4c(c3c(=O)c2c1CC=C(C)C)OC(C)(C)CC4 |
| InChI | InChI=1S/C24H26O6/c1-12(2)6-7-14-19-17(11-16(26)22(14)28-5)29-18-10-15(25)13-8-9-24(3,4)30-23(13)20(18)21(19)27/h6,10-11,25-26H,7-9H2,1-5H3 |
| InChIKey | JUHXHWKPHWGZKL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia mangostana (ncbitaxon:58228) | pericarp (BTO:0001017) | PubMed (24555285) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-isomangostin (CHEBI:636) has role plant metabolite (CHEBI:76924) |
| 1-isomangostin (CHEBI:636) is a cyclic ether (CHEBI:37407) |
| 1-isomangostin (CHEBI:636) is a cyclic ketone (CHEBI:3992) |
| 1-isomangostin (CHEBI:636) is a organic heterotetracyclic compound (CHEBI:38163) |
| 1-isomangostin (CHEBI:636) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5,9-dihydroxy-10-methoxy-2,2-dimethyl-11-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H,12H-pyrano[2,3-a]xanthen-12-one |
| Manual Xrefs | Databases |
|---|---|
| C00002958 | KNApSAcK |
| C10071 | KEGG COMPOUND |
| HMDB0029981 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1631615 | Reaxys |
| CAS:19275-44-6 | KEGG COMPOUND |
| Citations |
|---|