EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO2 |
| Net Charge | 0 |
| Average Mass | 275.392 |
| Monoisotopic Mass | 275.18853 |
| SMILES | O=C(O)CCCCNC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C17H25NO2/c19-16(20)11-5-8-14-18-17(12-6-2-7-13-17)15-9-3-1-4-10-15/h1,3-4,9-10,18H,2,5-8,11-14H2,(H,19,20) |
| InChIKey | RZGZMLICFFEUIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(1-phenylcyclohexyl)amino]pentanoic acid (CHEBI:63596) has functional parent valeric acid (CHEBI:17418) |
| 5-[(1-phenylcyclohexyl)amino]pentanoic acid (CHEBI:63596) has role metabolite (CHEBI:25212) |
| 5-[(1-phenylcyclohexyl)amino]pentanoic acid (CHEBI:63596) is a fatty acid derivative (CHEBI:61697) |
| 5-[(1-phenylcyclohexyl)amino]pentanoic acid (CHEBI:63596) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-[(1-phenylcyclohexyl)amino]pentanoic acid |
| Synonyms | Source |
|---|---|
| 5-(1-Phenylcyclohexylamino)valeric acid | ChemIDplus |
| 5-[N-(1'-phenylcyclohexyl)amino]pentanoic acid | ChEBI |
| 5-Pchap | ChemIDplus |
| PCHP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5282428 | Reaxys |
| CAS:77160-83-9 | ChemIDplus |
| Citations |
|---|