EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N2O2 |
| Net Charge | 0 |
| Average Mass | 334.419 |
| Monoisotopic Mass | 334.16813 |
| SMILES | CN(CCCCC(=O)O)c1ccc(/C=C/c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-23(15-3-2-4-21(24)25)20-13-11-18(12-14-20)6-5-17-7-9-19(16-22)10-8-17/h5-14H,2-4,15H2,1H3,(H,24,25)/b6-5+ |
| InChIKey | ZJVNDTIARCDQHR-AATRIKPKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-{N-[4-(4-cyanostyryl)phenyl]-N-methylamino}pentanoic acid (CHEBI:63595) is a monocarboxylic acid (CHEBI:25384) |
| 5-{N-[4-(4-cyanostyryl)phenyl]-N-methylamino}pentanoic acid (CHEBI:63595) is a nitrile (CHEBI:18379) |
| 5-{N-[4-(4-cyanostyryl)phenyl]-N-methylamino}pentanoic acid (CHEBI:63595) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5-[{4-[(E)-2-(4-cyanophenyl)ethenyl]phenyl}(methyl)amino]pentanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10700840 | Reaxys |
| Citations |
|---|