EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15BrN6O |
| Net Charge | 0 |
| Average Mass | 435.285 |
| Monoisotopic Mass | 434.04907 |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)nc(N)c1Br |
| InChI | InChI=1S/C20H15BrN6O/c1-11-7-14(10-23)8-12(2)17(11)28-19-16(21)18(24)26-20(27-19)25-15-5-3-13(9-22)4-6-15/h3-8H,1-2H3,(H3,24,25,26,27) |
| InChIKey | PYGWGZALEOIKDF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etravirine (CHEBI:63589) has role antiviral agent (CHEBI:22587) |
| etravirine (CHEBI:63589) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| etravirine (CHEBI:63589) is a aminopyrimidine (CHEBI:38338) |
| etravirine (CHEBI:63589) is a aromatic ether (CHEBI:35618) |
| etravirine (CHEBI:63589) is a dinitrile (CHEBI:51308) |
| etravirine (CHEBI:63589) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| 4-({6-amino-5-bromo-2-[(4-cyanophenyl)amino]pyrimidin-4-yl}oxy)-3,5-dimethylbenzonitrile |
| INN | Source |
|---|---|
| etravirine | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D04112 | KEGG DRUG |
| DB06414 | DrugBank |
| Etravirine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8945855 | Reaxys |
| CAS:269055-15-4 | ChemIDplus |
| CAS:269055-15-4 | KEGG DRUG |
| Citations |
|---|