EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H57NO14 |
| Net Charge | 0 |
| Average Mass | 835.944 |
| Monoisotopic Mass | 835.37791 |
| SMILES | [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C(C)=C([C@@H](OC)C(=O)[C@]1(C)[C@@H](OC)C[C@H]1OC[C@]12OC(C)=O)C3(C)C |
| InChI | InChI=1S/C45H57NO14/c1-24-28(57-39(51)33(48)32(26-17-13-11-14-18-26)46-40(52)60-41(3,4)5)22-45(53)37(58-38(50)27-19-15-12-16-20-27)35-43(8,36(49)34(55-10)31(24)42(45,6)7)29(54-9)21-30-44(35,23-56-30)59-25(2)47/h11-20,28-30,32-35,37,48,53H,21-23H2,1-10H3,(H,46,52)/t28-,29-,30+,32-,33+,34+,35-,37-,43+,44-,45+/m0/s1 |
| InChIKey | BMQGVNUXMIRLCK-OAGWZNDDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | microtubule-stabilising agent Any substance that interacts with tubulin to promote polymerisation of microtubules. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabazitaxel (CHEBI:63584) has functional parent 10-deacetylbaccatin III (CHEBI:18193) |
| cabazitaxel (CHEBI:63584) has role antineoplastic agent (CHEBI:35610) |
| cabazitaxel (CHEBI:63584) has role microtubule-stabilising agent (CHEBI:61950) |
| cabazitaxel (CHEBI:63584) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (2α,5β,7β,10β,13α)-4-acetoxy-13-({(2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoyl}oxy)-1-hydroxy-7,10-dimethoxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| INNs | Source |
|---|---|
| cabazitaxel | WHO MedNet |
| cabazitaxel | WHO MedNet |
| cabazitaxel | KEGG DRUG |
| cabazitaxelum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4153 | DrugCentral |
| Cabazitaxel | Wikipedia |
| D09755 | KEGG DRUG |
| DB06772 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14351224 | Reaxys |
| CAS:183133-96-2 | KEGG DRUG |
| CAS:183133-96-2 | ChemIDplus |
| Citations |
|---|