EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O4 |
| Net Charge | 0 |
| Average Mass | 224.216 |
| Monoisotopic Mass | 224.07971 |
| SMILES | Cc1cn([C@H]2C=C[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H12N2O4/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8/h2-4,7-8,13H,5H2,1H3,(H,11,14,15)/t7-,8+/m0/s1 |
| InChIKey | XNKLLVCARDGLGL-JGVFFNPUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. antiviral agent A substance that destroys or inhibits replication of viruses. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stavudine (CHEBI:63581) has functional parent thymine (CHEBI:17821) |
| stavudine (CHEBI:63581) has role antimetabolite (CHEBI:35221) |
| stavudine (CHEBI:63581) has role antiviral agent (CHEBI:22587) |
| stavudine (CHEBI:63581) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| stavudine (CHEBI:63581) is a dihydrofuran (CHEBI:51659) |
| stavudine (CHEBI:63581) is a nucleoside analogue (CHEBI:60783) |
| stavudine (CHEBI:63581) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-[(2R,5S)-5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione |
| INNs | Source |
|---|---|
| stavudine | KEGG DRUG |
| estavudina | DrugBank |
| stavudinum | DrugBank |
| Synonyms | Source |
|---|---|
| Stavudine | KEGG COMPOUND |
| d4T | KEGG COMPOUND |
| 2',3'-Didehydro-3'-deoxythimidine | KEGG COMPOUND |
| Sanilvudine | KEGG COMPOUND |
| 3'-Deoxy-2'-thymidinene | DrugBank |
| STV | DrugBank |