EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11N3O3S |
| Net Charge | 0 |
| Average Mass | 229.261 |
| Monoisotopic Mass | 229.05211 |
| SMILES | Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7+/m0/s1 |
| InChIKey | JTEGQNOMFQHVDC-NKWVEPMBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the activity of reverse transcriptase, EC 2.7.7.49, a viral DNA polymerase enzyme that retroviruses need in order to reproduce. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamivudine (CHEBI:63577) has functional parent cytosine (CHEBI:16040) |
| lamivudine (CHEBI:63577) has role allergen (CHEBI:50904) |
| lamivudine (CHEBI:63577) has role anti-HBV agent (CHEBI:64951) |
| lamivudine (CHEBI:63577) has role antiviral drug (CHEBI:36044) |
| lamivudine (CHEBI:63577) has role EC 2.7.7.49 (RNA-directed DNA polymerase) inhibitor (CHEBI:59897) |
| lamivudine (CHEBI:63577) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| lamivudine (CHEBI:63577) has role prodrug (CHEBI:50266) |
| lamivudine (CHEBI:63577) is a monothioacetal (CHEBI:59793) |
| lamivudine (CHEBI:63577) is a nucleoside analogue (CHEBI:60783) |
| lamivudine (CHEBI:63577) is a oxacycle (CHEBI:38104) |
| lamivudine (CHEBI:63577) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2(1H)-one |
| INN | Source |
|---|---|
| lamivudine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (-)-1-((2R,5S)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl)cytosine | ChemIDplus |
| 2',3'-Dideoxy-3'-thiacytidine | KEGG COMPOUND |
| (-)-2'-Deoxy-3'-thiacytidine | ChemIDplus |
| 3TC | KEGG COMPOUND |
| 3'-Thia-2',3'-dideoxycytidine | ChemIDplus |
| beta-L-2',3'-Dideoxy-3'-thiacytidine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Epivir | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5480511 | Reaxys |
| CAS:134678-17-4 | KEGG COMPOUND |
| CAS:134678-17-4 | ChemIDplus |
| Citations |
|---|