EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18N2 |
| Net Charge | 0 |
| Average Mass | 226.323 |
| Monoisotopic Mass | 226.14700 |
| SMILES | CC(C)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C15H18N2/c1-12(2)16-14-8-10-15(11-9-14)17-13-6-4-3-5-7-13/h3-12,16-17H,1-2H3 |
| InChIKey | OUBMGJOQLXMSNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-isopropyl-N'-phenyl-p-phenylenediamine (CHEBI:63569) has role allergen (CHEBI:50904) |
| N-isopropyl-N'-phenyl-p-phenylenediamine (CHEBI:63569) has role antioxidant (CHEBI:22586) |
| N-isopropyl-N'-phenyl-p-phenylenediamine (CHEBI:63569) is a N-substituted diamine (CHEBI:50441) |
| IUPAC Name |
|---|
| N-isopropyl-N'-phenylbenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| N-isopropyl-N'-phenyl-1,4-phenylenediamine | ChEBI |
| 4-(Isopropylamino)diphenylamine | ChemIDplus |
| 4-Anilino-N-isopropylaniline | ChemIDplus |
| -Isopropylaminodiphenylamine | ChemIDplus |
| N-(1-methylethyl)-N'-phenyl-1,4-benzenediamine | NIST Chemistry WebBook |
| IPPD | ChEBI |
| Citations |
|---|