EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63559 - HBOA
| Formula | C8H7NO3 |
| Net Charge | 0 |
| Average Mass | 165.148 |
| Monoisotopic Mass | 165.04259 |
| SMILES | O=C1Nc2ccccc2OC1O |
| InChI | InChI=1S/C8H7NO3/c10-7-8(11)12-6-4-2-1-3-5(6)9-7/h1-4,8,11H,(H,9,10) |
| InChIKey | VMQBFYRBJKDACN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aphelandra tetragona (ncbitaxon:328118) | root (BTO:0001188) | PubMed (10680174) |
| Roles Classification |
|---|
| Biological Roles: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HBOA (CHEBI:63559) has role allelochemical (CHEBI:62215) |
| HBOA (CHEBI:63559) has role plant metabolite (CHEBI:76924) |
| HBOA (CHEBI:63559) is a benzoxazine (CHEBI:46969) |
| HBOA (CHEBI:63559) is a lactam (CHEBI:24995) |
| HBOA (CHEBI:63559) is a lactol (CHEBI:38131) |
| Incoming Relation(s) |
| HMBOA β-D-glucoside (CHEBI:134457) has functional parent HBOA (CHEBI:63559) |
| IUPAC Name |
|---|
| 2-hydroxy-2H-1,4-benzoxazin-3(4H)-one |
| Synonym | Source |
|---|---|
| 2-Hydroxy-1,4-benzoxazin-3-one | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-2H-1,4-benzoxazin-3(4H)-one | UniProt |
| Citations |
|---|