EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N4O3 |
| Net Charge | 0 |
| Average Mass | 314.345 |
| Monoisotopic Mass | 314.13789 |
| SMILES | CCN(CCO)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-2-19(11-12-21)15-7-3-13(4-8-15)17-18-14-5-9-16(10-6-14)20(22)23/h3-10,21H,2,11-12H2,1H3/b18-17+ |
| InChIKey | FOQABOMYTOFLPZ-ISLYRVAYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disperse Red 1 (CHEBI:63557) has functional parent azobenzene (CHEBI:190358) |
| Disperse Red 1 (CHEBI:63557) has role allergen (CHEBI:50904) |
| Disperse Red 1 (CHEBI:63557) has role dye (CHEBI:37958) |
| Disperse Red 1 (CHEBI:63557) is a azobenzenes (CHEBI:22682) |
| Disperse Red 1 (CHEBI:63557) is a monoazo compound (CHEBI:48959) |
| IUPAC Name |
|---|
| 2-(ethyl{4-[(E)-(4-nitrophenyl)diazenyl]phenyl}amino)ethanol |
| Synonyms | Source |
|---|---|
| 2-[N-ethyl-4-(4-nitrophenylazo)phenyl-amino]ethanol | ChEBI |
| 2-(Ethyl(4-((4-nitrophenyl)azo)phenyl)amino)ethanol | ChemIDplus |
| 4-[N-(2-hydroxyethyl)-N-ethylamino]-4'-nitroazobenzene | ChEBI |
| 4-[N-ethyl-N-(β-hydroxyethyl)]amino-4'-nitroazobenzene | ChEBI |
| 4-[ethyl(2-hydroxyethyl)amino]-4'-nitroazobenzene | ChEBI |
| 4-Nitro-4'-(ethyl(2-hydroxyethyl)amino)azobenzene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5353614 | Reaxys |
| CAS:2872-52-8 | ChemIDplus |
| Citations |
|---|