EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N2O15P3 |
| Net Charge | 0 |
| Average Mass | 498.167 |
| Monoisotopic Mass | 497.98418 |
| SMILES | Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)nc1=O |
| InChI | InChI=1S/C10H17N2O15P3/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(25-9)3-24-29(20,21)27-30(22,23)26-28(17,18)19/h2,5-7,9,13-14H,3H2,1H3,(H,20,21)(H,22,23)(H,11,15,16)(H2,17,18,19)/t5-,6-,7-,9-/m1/s1 |
| InChIKey | RZCIEJXAILMSQK-JXOAFFINSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TTP (CHEBI:63550) is a pyrimidine ribonucleoside 5'-triphosphate (CHEBI:37044) |
| TTP (CHEBI:63550) is conjugate acid of TTP(4−) (CHEBI:63527) |
| Incoming Relation(s) |
| TTP(4−) (CHEBI:63527) is conjugate base of TTP (CHEBI:63550) |
| IUPAC Name |
|---|
| 5-methyluridine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| ribothymidine triphosphate | ChEBI |
| 5-methyl-UTP | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:773021 | Reaxys |