EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO3 |
| Net Charge | 0 |
| Average Mass | 309.365 |
| Monoisotopic Mass | 309.13649 |
| SMILES | O=C(O)CCCC(=O)Nc1ccc(/C=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO3/c21-18(7-4-8-19(22)23)20-17-13-11-16(12-14-17)10-9-15-5-2-1-3-6-15/h1-3,5-6,9-14H,4,7-8H2,(H,20,21)(H,22,23)/b10-9- |
| InChIKey | FTXJWRRYLLRFMG-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-4-glutaramidostilbene (CHEBI:63538) is a dicarboxylic acid monoamide (CHEBI:35735) |
| (Z)-4-glutaramidostilbene (CHEBI:63538) is a monocarboxylic acid (CHEBI:25384) |
| (Z)-4-glutaramidostilbene (CHEBI:63538) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 5-oxo-5-({4-[(Z)-2-phenylethenyl]phenyl}amino)pentanoic acid |
| Synonyms | Source |
|---|---|
| cis-4-glutaramidostilbene | ChEBI |
| 5-oxo-5-({4-[(Z)-2-phenylvinyl]phenyl}amino)pentanoic acid | IUPAC |
| Citations |
|---|