EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C2H4O2.C66H86N18O12 |
| Net Charge | 0 |
| Average Mass | 1443.632 |
| Monoisotopic Mass | 1442.70952 |
| SMILES | CC(=O)O.CC(=O)O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1cn(Cc2ccccc2)cn1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C66H86N18O12.2C2H4O2/c1-4-70-64(95)55-17-11-25-84(55)65(96)48(16-10-24-71-66(67)68)76-58(89)49(26-38(2)3)77-62(93)53(30-43-34-83(37-74-43)33-40-12-6-5-7-13-40)81-59(90)50(27-39-18-20-44(86)21-19-39)78-63(94)54(35-85)82-60(91)51(28-41-31-72-46-15-9-8-14-45(41)46)79-61(92)52(29-42-32-69-36-73-42)80-57(88)47-22-23-56(87)75-47;2*1-2(3)4/h5-9,12-15,18-21,31-32,34,36-38,47-55,72,85-86H,4,10-11,16-17,22-30,33,35H2,1-3H3,(H,69,73)(H,70,95)(H,75,87)(H,76,89)(H,77,93)(H,78,94)(H,79,92)(H,80,88)(H,81,90)(H,82,91)(H4,67,68,71);2*1H3,(H,3,4)/t47-,48-,49-,50-,51-,52-,53+,54-,55-;;/m0../s1 |
| InChIKey | BKEMVGVBBDMHKL-VYFXDUNUSA-N |
| Roles Classification |
|---|
| Biological Role: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| Applications: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| histrelin acetate (CHEBI:63530) has part histrelin (CHEBI:5739) |
| histrelin acetate (CHEBI:63530) has role antineoplastic agent (CHEBI:35610) |
| histrelin acetate (CHEBI:63530) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| histrelin acetate (CHEBI:63530) is a acetate salt (CHEBI:59230) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-1-benzyl-D-histidyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide—acetic acid (1/2) |
| Brand Names | Source |
|---|---|
| Suprellin | ChEBI |
| Suprellin LA | ChEBI |
| Vantas | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D02116 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10328535 | Reaxys |
| Reaxys:15590018 | Reaxys |
| CAS:220810-26-4 | ChemIDplus |