EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N2O7 |
| Net Charge | -1 |
| Average Mass | 307.323 |
| Monoisotopic Mass | 307.15107 |
| SMILES | N[C@@H](CCCCNCC(=O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)[O-] |
| InChI | InChI=1S/C12H24N2O7/c13-7(12(20)21)3-1-2-4-14-5-8(16)10(18)11(19)9(17)6-15/h7,9-11,14-15,17-19H,1-6,13H2,(H,20,21)/p-1/t7-,9+,10+,11+/m0/s1 |
| InChIKey | BFSYFTQDGRDJNV-AYHFEMFVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fructosyllysinate (CHEBI:63523) is a glyco-amino-acid anion (CHEBI:63790) |
| fructosyllysinate (CHEBI:63523) is conjugate base of fructosyllysine (CHEBI:24109) |
| Incoming Relation(s) |
| fructosyllysine (CHEBI:24109) is conjugate acid of fructosyllysinate (CHEBI:63523) |
| Synonym | Source |
|---|---|
| fructosyllysine anion | SUBMITTER |