EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N4 |
| Net Charge | 0 |
| Average Mass | 168.244 |
| Monoisotopic Mass | 168.13750 |
| SMILES | C1CN2CN1CN1CCN(C1)C2 |
| InChI | InChI=1S/C8H16N4/c1-2-10-5-9(1)7-11-3-4-12(6-11)8-10/h1-8H2 |
| InChIKey | ZBFHXDNNFOOFLY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane (CHEBI:63487) has role antineoplastic agent (CHEBI:35610) |
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane (CHEBI:63487) has role apoptosis inducer (CHEBI:68495) |
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane (CHEBI:63487) is a azatricycloalkane (CHEBI:63489) |
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane (CHEBI:63487) is a bridged compound (CHEBI:35990) |
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane (CHEBI:63487) is a tetramine (CHEBI:39166) |
| IUPAC Name |
|---|
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane |
| Synonyms | Source |
|---|---|
| 1,3,6,8-diendomethylene-1,3,6,8-tetraazacyclodecane | ChEBI |
| 1,3,6,8-tetraazatricyclo[6.2.1.13,6]dodecane | ChemIDplus |
| 1,3,6,8-tetraazatricyclo[6.2.1.1(3,6)]dodecane | ChEBI |
| NSC 4436 | ChemIDplus |
| SMBA2 | ChEBI |
| Brand Name | Source |
|---|---|
| Dimtac | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:606681 | Reaxys |
| CAS:18304-79-5 | ChemIDplus |
| CAS:281-86-7 | ChemIDplus |
| Citations |
|---|