EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10NO7P |
| Net Charge | 0 |
| Average Mass | 227.109 |
| Monoisotopic Mass | 227.01949 |
| SMILES | O=C(O)CN(CC(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C5H10NO7P/c7-4(8)1-6(2-5(9)10)3-14(11,12)13/h1-3H2,(H,7,8)(H,9,10)(H2,11,12,13) |
| InChIKey | AZIHIQIVLANVKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(phosphonomethyl)iminodiacetic acid (CHEBI:63485) is a amino dicarboxylic acid (CHEBI:36164) |
| N-(phosphonomethyl)iminodiacetic acid (CHEBI:63485) is a glycine derivative (CHEBI:24373) |
| N-(phosphonomethyl)iminodiacetic acid (CHEBI:63485) is a phosphonic acids (CHEBI:26069) |
| N-(phosphonomethyl)iminodiacetic acid (CHEBI:63485) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2,2'-[(phosphonomethyl)imino]diacetic acid |
| Synonyms | Source |
|---|---|
| N-(Carboxymethyl)-N-(phosphonomethyl)glycine | ChemIDplus |
| Phosphonomethyliminodiacetic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CN101648969 | Patent |
| CN101619076 | Patent |
| CN101602779 | Patent |
| WO9324611 | Patent |
| EP0439445 | Patent |
| WO9640698 | Patent |
| EP0464017 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1795744 | Reaxys |
| CAS:5994-61-6 | ChemIDplus |
| Citations |
|---|