EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@]([H])([C@@H](C)CCC=C(C)C)CC[C@]3(C)C1=CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,12,21-23,25-26,31H,9,11,13-19H2,1-8H3/t21-,22-,23-,25-,26-,28+,29-,30+/m0/s1 |
| InChIKey | DICCPNLDOZNSML-CEEMYSEHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dysoxylum lenticellatum (IPNI:578201-1) | |||
| leaf (BTO:0000713) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. | |
| twig (BTO:0001411) | PubMed (21954912) | 95% Ethanolic extract of air-dried, powdered leaves and twigs. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tirucalla-7,24-dien-3β-ol (CHEBI:63468) has role plant metabolite (CHEBI:76924) |
| tirucalla-7,24-dien-3β-ol (CHEBI:63468) is a tirucallane triterpenoid (CHEBI:83211) |
| IUPAC Name |
|---|
| (13α,14β,17α,20S)-lanosta-7,24-dien-3β-ol |
| Synonyms | Source |
|---|---|
| (3β,13α,14β,17α,20S)-lanosta-7,24-dien-3-ol | IUPAC |
| 5α-tirucalla-7,24-dien-3β-ol | ChEBI |
| tirucalladienol | ChEBI |
| Δ7-tirucallol | ChEBI |
| UniProt Name | Source |
|---|---|
| tirucalla-7,24-dien-3β-ol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2340080 | Reaxys |
| Citations |
|---|