EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CCC=C(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,15,21-22,24-26,31H,9,11-14,16-19H2,1-8H3/t21-,22-,24-,25+,26+,28-,29-,30+/m1/s1 |
| InChIKey | MLVSYGCURCOSKP-FXCPCPCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| parkeol (CHEBI:63460) has parent hydride lanostane (CHEBI:20265) |
| parkeol (CHEBI:63460) has role metabolite (CHEBI:25212) |
| parkeol (CHEBI:63460) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| parkeol (CHEBI:63460) is a 3β-sterol (CHEBI:35348) |
| parkeol (CHEBI:63460) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| lanosta-9(11),24-dien-3β-ol |
| Synonyms | Source |
|---|---|
| 4,4,14α-trimethyl-5α-cholesta-9(11),24-dien-3β-ol | IUPAC |
| 5α-lanosta-9(11),24-dien-3β-ol | ChEBI |
| Δ9(11),24-lanostadien-3β-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| parkeol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CN101633913 | Patent |
| CPD-13879 | MetaCyc |
| Citations |
|---|