EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6346 - Labriformin
| Formula | C31H39NO10S |
| Net Charge | 0 |
| Average Mass | 617.717 |
| Monoisotopic Mass | 617.22947 |
| SMILES | [H][C@@]12C[C@@H]3O[C@@]34[C@@]3(O)CC[C@]([H])(C5=CC(=O)OC5)[C@@]3(C)C(=O)[C@@H](O)[C@]4([H])[C@@]1(C)C[C@@]1([H])O[C@@]3(O)C4(C[C@@H](C)O[C@@]3([H])O[C@]1([H])C2)N=CCS4 |
| InChI | InChI=1S/C31H39NO10S/c1-14-11-29(32-6-7-43-29)31(37)25(39-14)40-18-9-16-10-20-30(42-20)23(26(16,2)12-19(18)41-31)22(34)24(35)27(3)17(4-5-28(27,30)36)15-8-21(33)38-13-15/h6,8,14,16-20,22-23,25,34,36-37H,4-5,7,9-13H2,1-3H3/t14-,16-,17-,18-,19-,20+,22+,23-,25+,26+,27+,28-,29?,30+,31-/m1/s1 |
| InChIKey | BGKAKFOJZRBENJ-YWBLJHEQSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Labriformin (CHEBI:6346) is a cardenolide glycoside (CHEBI:38092) |
| Synonym | Source |
|---|---|
| Labriformin | KEGG COMPOUND |