EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33N5O3 |
| Net Charge | 0 |
| Average Mass | 463.582 |
| Monoisotopic Mass | 463.25834 |
| SMILES | COc1cc(CCc2cc(NC(=O)c3ccc(N4C[C@@H](C)N[C@@H](C)C4)cc3)nn2)cc(OC)c1 |
| InChI | InChI=1S/C26H33N5O3/c1-17-15-31(16-18(2)27-17)22-9-6-20(7-10-22)26(32)28-25-13-21(29-30-25)8-5-19-11-23(33-3)14-24(12-19)34-4/h6-7,9-14,17-18,27H,5,8,15-16H2,1-4H3,(H2,28,29,30,32)/t17-,18+ |
| InChIKey | VRQMAABPASPXMW-HDICACEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD4547 (CHEBI:63453) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| AZD4547 (CHEBI:63453) is a N-arylpiperazine (CHEBI:46848) |
| AZD4547 (CHEBI:63453) is a benzamides (CHEBI:22702) |
| AZD4547 (CHEBI:63453) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| N-{5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl}-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]benzamide |
| Synonyms | Source |
|---|---|
| AZD-4547 | ChEBI |
| N-{5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl}-4-(cis-3,5-dimethylpiperazin-1-yl)benzamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6308 | LINCS |