EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31Cl2N7O3 |
| Net Charge | 0 |
| Average Mass | 560.486 |
| Monoisotopic Mass | 559.18654 |
| SMILES | CCN1CCN(c2ccc(Nc3cc(N(C)C(=O)Nc4c(Cl)c(OC)cc(OC)c4Cl)ncn3)cc2)CC1 |
| InChI | InChI=1S/C26H31Cl2N7O3/c1-5-34-10-12-35(13-11-34)18-8-6-17(7-9-18)31-21-15-22(30-16-29-21)33(2)26(36)32-25-23(27)19(37-3)14-20(38-4)24(25)28/h6-9,14-16H,5,10-13H2,1-4H3,(H,32,36)(H,29,30,31) |
| InChIKey | QADPYRIHXKWUSV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BGJ-398 (CHEBI:63451) has role antineoplastic agent (CHEBI:35610) |
| BGJ-398 (CHEBI:63451) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| BGJ-398 (CHEBI:63451) is a N-alkylpiperazine (CHEBI:46845) |
| BGJ-398 (CHEBI:63451) is a N-arylpiperazine (CHEBI:46848) |
| BGJ-398 (CHEBI:63451) is a aminopyrimidine (CHEBI:38338) |
| BGJ-398 (CHEBI:63451) is a dichlorobenzene (CHEBI:23697) |
| BGJ-398 (CHEBI:63451) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(6-{[4-(4-ethylpiperazin-1-yl)phenyl]amino}pyrimidin-4-yl)-1-methylurea |
| Synonyms | Source |
|---|---|
| BGJ398 | ChEBI |
| NVP-BGJ398 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-1184 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12512466 | Reaxys |
| Citations |
|---|