EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36O11 |
| Net Charge | 0 |
| Average Mass | 560.596 |
| Monoisotopic Mass | 560.22576 |
| SMILES | [H][C@@]12C[C@@H]3O[C@@]34[C@@]3(O)CC[C@]([H])(C5=CC(=O)OC5)[C@@]3(C)C(=O)[C@@H](O)[C@]4([H])[C@@]1(C)C[C@@]1([H])O[C@@]3(O)C(=O)C[C@@H](C)O[C@@]3([H])O[C@]1([H])C2 |
| InChI | InChI=1S/C29H36O11/c1-12-6-18(30)29(35)24(37-12)38-16-8-14-9-19-28(40-19)22(25(14,2)10-17(16)39-29)21(32)23(33)26(3)15(4-5-27(26,28)34)13-7-20(31)36-11-13/h7,12,14-17,19,21-22,24,32,34-35H,4-6,8-11H2,1-3H3/t12-,14-,15-,16-,17-,19+,21+,22-,24+,25+,26+,27-,28+,29+/m1/s1 |
| InChIKey | WSTYKMSHUMUSAY-HBXZBPGDSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Labriformidin (CHEBI:6345) is a cardenolide glycoside (CHEBI:38092) |
| Synonym | Source |
|---|---|
| Labriformidin | KEGG COMPOUND |