EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N2O3 |
| Net Charge | 0 |
| Average Mass | 296.326 |
| Monoisotopic Mass | 296.11609 |
| SMILES | [H]C(=C1C(=O)Nc2ccccc21)c1ncc(C)c1CCC(=O)O |
| InChI | InChI=1S/C17H16N2O3/c1-10-9-18-15(11(10)6-7-16(20)21)8-13-12-4-2-3-5-14(12)19-17(13)22/h2-5,8-9,18H,6-7H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | JNDVEAXZWJIOKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fibroblast growth factor receptor antagonist An antagonist at the fibroblast growth factor receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SU5402 (CHEBI:63449) has functional parent 3-methyleneoxindole (CHEBI:17920) |
| SU5402 (CHEBI:63449) has role fibroblast growth factor receptor antagonist (CHEBI:63457) |
| SU5402 (CHEBI:63449) is a monocarboxylic acid (CHEBI:25384) |
| SU5402 (CHEBI:63449) is a oxindoles (CHEBI:38459) |
| SU5402 (CHEBI:63449) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 3-{4-methyl-2-[(2-oxo-1,2-dihydro-3H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl}propanoic acid |
| Synonyms | Source |
|---|---|
| 3-[3-(2-carboxyethyl)-4-methylpyrrol-2-methylidenyl]-2-indolinone | SUBMITTER |
| SU 5402 | ChEBI |
| SU-5402 | ChEBI |
| 3-{[3-(2-carboxyethyl)-4-methylpyrrol-2-yl]methylene}-2-indolinone | ChEBI |
| Su-5402 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8004406 | Reaxys |