EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12C[C@H](C(=C)C)CCC(C)=C1CC[C@@H]2C |
| InChI | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h12-13,15H,1,5-9H2,2-4H3/t12-,13+,15-/m0/s1 |
| InChIKey | YHAJBLWYOIUHHM-GUTXKFCHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-guaiene (CHEBI:63447) has role plant metabolite (CHEBI:76924) |
| δ-guaiene (CHEBI:63447) has role platelet aggregation inhibitor (CHEBI:50427) |
| δ-guaiene (CHEBI:63447) is a carbobicyclic compound (CHEBI:36785) |
| δ-guaiene (CHEBI:63447) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (3S,3aS,5R)-3,8-dimethyl-5-(prop-1-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroazulene |
| Synonyms | Source |
|---|---|
| α-bulnesene | SUBMITTER |
| (+)-α-bulnesene | ChEBI |
| UniProt Name | Source |
|---|---|
| δ-guaiene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12888 | MetaCyc |
| CN1955151 | Patent |
| HMDB0036444 | HMDB |
| Guaiene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2046233 | Reaxys |
| CAS:3691-11-0 | ChemIDplus |
| Citations |
|---|