EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63443 - α-guaiene
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1CC[C@H](C)C2=C(C1)[C@@H](C)CC2 |
| InChI | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+/m0/s1 |
| InChIKey | ADIDQIZBYUABQK-RWMBFGLXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pogostemon cablin (ncbitaxon:28511) | |||
| stem (BTO:0001300) | PubMed (MED:12575075) | ||
| leaf (BTO:0000713) | PubMed (MED:12575075) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-guaiene (CHEBI:63443) has role plant metabolite (CHEBI:76924) |
| α-guaiene (CHEBI:63443) has role volatile oil component (CHEBI:27311) |
| α-guaiene (CHEBI:63443) is a carbobicyclic compound (CHEBI:36785) |
| α-guaiene (CHEBI:63443) is a sesquiterpene (CHEBI:35189) |
| IUPAC Names |
|---|
| guaia-1(5),11-diene |
| (1S,4S,7R)-1,4-dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,5,6,7,8-octahydroazulene |
| UniProt Name | Source |
|---|---|
| α-guaiene | UniProt |
| Citations |
|---|