EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O3.HCl |
| Net Charge | 0 |
| Average Mass | 364.873 |
| Monoisotopic Mass | 364.15537 |
| SMILES | CC(CCc1ccccc1)NCC(O)c1ccc(O)c(C(N)=O)c1.Cl |
| InChI | InChI=1S/C19H24N2O3.ClH/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24;/h2-6,9-11,13,18,21-23H,7-8,12H2,1H3,(H2,20,24);1H |
| InChIKey | WQVZLXWQESQGIF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Labetalol hydrochloride (CHEBI:6344) has role antihypertensive agent (CHEBI:35674) |
| Labetalol hydrochloride (CHEBI:6344) is a salicylamides (CHEBI:53443) |
| Synonyms | Source |
|---|---|
| AH 5158A | ChEMBL |
| AH-5158A | ChEMBL |
| AH-5158A HYDROCHLORIDE | ChEMBL |
| Ibidomide hydrochloride | ChEMBL |
| Labetalol hcl | ChEMBL |
| Labetalol hydrochloride | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Labetalol hydrochloride component of normozide | ChEMBL |
| Labetalol hydrochloride in dextrose | ChEMBL |
| Labetalol hydrochloride in sodium chloride | ChEMBL |
| Labetalol hydrocloride | ChEMBL |
| Labrocol | ChEMBL |
| Normodyne | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00600 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:32780-64-6 | KEGG COMPOUND |
| Citations |
|---|