EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O4 |
| Net Charge | 0 |
| Average Mass | 190.199 |
| Monoisotopic Mass | 190.09536 |
| SMILES | N[C@@H](CCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | GMKMEZVLHJARHF-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LL-2,6-diaminopimelic acid (CHEBI:16026) has role Escherichia coli metabolite (CHEBI:76971) |
| LL-2,6-diaminopimelic acid (CHEBI:16026) is a 2,6-diaminopimelic acid (CHEBI:23673) |
| LL-2,6-diaminopimelic acid (CHEBI:16026) is conjugate acid of LL-2,6-diaminopimelate(2−) (CHEBI:47031) |
| LL-2,6-diaminopimelic acid (CHEBI:16026) is tautomer of (2S,6S)-2,6-diaminopimelic acid dizwitterion (CHEBI:57609) |
| Incoming Relation(s) |
| N-acetyl-LL-2,6-diaminopimelic acid (CHEBI:49004) has functional parent LL-2,6-diaminopimelic acid (CHEBI:16026) |
| N-succinyl-LL-2,6-diaminopimelic acid (CHEBI:17279) has functional parent LL-2,6-diaminopimelic acid (CHEBI:16026) |
| LL-2,6-diaminopimelate(2−) (CHEBI:47031) is conjugate base of LL-2,6-diaminopimelic acid (CHEBI:16026) |
| (2S,6S)-2,6-diaminopimelic acid dizwitterion (CHEBI:57609) is tautomer of LL-2,6-diaminopimelic acid (CHEBI:16026) |
| IUPAC Name |
|---|
| (2S,6S)-2,6-diaminoheptanedioic acid |
| Synonyms | Source |
|---|---|
| (S-(R*,R*))-2,6-diaminoheptanedioic acid | ChemIDplus |
| (S,S)-2,6-diaminopimelic acid | ChEBI |
| LL-2,6-Diaminoheptanedioate | KEGG COMPOUND |
| LL-2,6-Diaminopimelate | KEGG COMPOUND |
| LL-2,6-Diaminopimelic acid | KEGG COMPOUND |
| L,L-2,6-diaminopimelic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00007596 | KNApSAcK |
| C00666 | KEGG COMPOUND |
| HMDB0001370 | HMDB |
| LMFA01170102 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726901 | Reaxys |
| CAS:14289-34-0 | ChemIDplus |