EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12N2O4 |
| Net Charge | -2 |
| Average Mass | 188.183 |
| Monoisotopic Mass | 188.08080 |
| SMILES | N[C@@H](CCC[C@H](N)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/p-2/t4-,5-/m0/s1 |
| InChIKey | GMKMEZVLHJARHF-WHFBIAKZSA-L |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LL-2,6-diaminopimelate(2−) (CHEBI:47031) is a 2,6-diaminopimelate(2−) (CHEBI:23671) |
| LL-2,6-diaminopimelate(2−) (CHEBI:47031) is conjugate base of LL-2,6-diaminopimelic acid (CHEBI:16026) |
| Incoming Relation(s) |
| LL-2,6-diaminopimelic acid (CHEBI:16026) is conjugate acid of LL-2,6-diaminopimelate(2−) (CHEBI:47031) |
| IUPAC Name |
|---|
| (2S,6S)-2,6-diaminoheptanedioate |
| Synonyms | Source |
|---|---|
| (S,S)-2,6-diaminopimelate(2−) | ChEBI |
| LL-2,6-diaminopimelate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00666 | KEGG COMPOUND |