EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63334 - rolitetracycline
| Formula | C27H33N3O8 |
| Net Charge | 0 |
| Average Mass | 527.574 |
| Monoisotopic Mass | 527.22677 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCN4CCCC4)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14-,15-,20-,26+,27-/m0/s1 |
| InChIKey | HMEYVGGHISAPJR-IAHYZSEUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolitetracycline (CHEBI:63334) has role antibacterial drug (CHEBI:36047) |
| rolitetracycline (CHEBI:63334) has role antiprotozoal drug (CHEBI:35820) |
| rolitetracycline (CHEBI:63334) has role prodrug (CHEBI:50266) |
| rolitetracycline (CHEBI:63334) has role protein synthesis inhibitor (CHEBI:48001) |
| rolitetracycline (CHEBI:63334) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| rolitetracycline (CHEBI:63334) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-N-(pyrrolidin-1-ylmethyl)-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| rolitetraciclina | ChemIDplus |
| rolitetracycline | KEGG DRUG |
| rolitetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| N-(1-Pyrrolidinylmethyl)-tetracycline | ChemIDplus |
| N-(Pyrrolidinomethyl)tetracycline | ChemIDplus |
| Pyrrolidino-methyl-tetracycline | ChemIDplus |
| Reverin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Synterin | KEGG DRUG |
| Citations |
|---|