EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N3O8 |
| Net Charge | 0 |
| Average Mass | 527.574 |
| Monoisotopic Mass | 527.22677 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCN4CCCC4)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14-,15-,20-,26+,27-/m0/s1 |
| InChIKey | HMEYVGGHISAPJR-IAHYZSEUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rolitetracycline (CHEBI:63334) has role antibacterial drug (CHEBI:36047) |
| rolitetracycline (CHEBI:63334) has role antiprotozoal drug (CHEBI:35820) |
| rolitetracycline (CHEBI:63334) has role prodrug (CHEBI:50266) |
| rolitetracycline (CHEBI:63334) has role protein synthesis inhibitor (CHEBI:48001) |
| rolitetracycline (CHEBI:63334) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| rolitetracycline (CHEBI:63334) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-N-(pyrrolidin-1-ylmethyl)-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| rolitetraciclina | ChemIDplus |
| rolitetracycline | KEGG DRUG |
| rolitetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| N-(1-Pyrrolidinylmethyl)-tetracycline | ChemIDplus |
| N-(Pyrrolidinomethyl)tetracycline | ChemIDplus |
| Pyrrolidino-methyl-tetracycline | ChemIDplus |
| Reverin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Synterin | KEGG DRUG |
| Citations |
|---|